C16H19BrN2O3S — CID 9157999
4-amino-N-[2-(4-bromo-2,6-dimethylphenoxy)ethyl]benzenesulfonamide (PubChem CID 9157999) has the molecular formula C16H19BrN2O3S and a molecular weight of 399.31 g/mol. Its IUPAC name is 4-amino-N-[2-(4-bromo-2,6-dimethylphenoxy)ethyl]benzenesulfonamide.
| Compound Name | 4-amino-N-[2-(4-bromo-2,6-dimethylphenoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9157999 |
| Molecular Formula | C16H19BrN2O3S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 4-amino-N-[2-(4-bromo-2,6-dimethylphenoxy)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(Br)cc(C)c1OCCNS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H19BrN2O3S/c1-11-9-13(17)10-12(2)16(11)22-8-7-19-23(20,21)15-5-3-14(18)4-6-15/h3-6,9-10,19H,7-8,18H2,1-2H3 |
| InChIKey | PEPPBULMRCUJPH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|