C9H15N3O4S2 — CID 43545911
4-amino-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide (PubChem CID 43545911) has the molecular formula C9H15N3O4S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-amino-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide.
| Compound Name | 4-amino-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43545911 |
| Molecular Formula | C9H15N3O4S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-amino-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)NCCNS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C9H15N3O4S2/c1-17(13,14)11-6-7-12-18(15,16)9-4-2-8(10)3-5-9/h2-5,11-12H,6-7,10H2,1H3 |
| InChIKey | CFLBZOQCDKRMAK-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|