C11H18N2O5S2 — CID 43546344
4-(1-hydroxyethyl)-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide (PubChem CID 43546344) has the molecular formula C11H18N2O5S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-(1-hydroxyethyl)-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide.
| Compound Name | 4-(1-hydroxyethyl)-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43546344 |
| Molecular Formula | C11H18N2O5S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-(1-hydroxyethyl)-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide |
| SMILES | CC(O)c1ccc(S(=O)(=O)NCCNS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H18N2O5S2/c1-9(14)10-3-5-11(6-4-10)20(17,18)13-8-7-12-19(2,15)16/h3-6,9,12-14H,7-8H2,1-2H3 |
| InChIKey | QXKVFCDBNCKART-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|