C12H20N2O5S2 — CID 106341917
3-(1-hydroxyethyl)-N-[3-(methanesulfonamido)propyl]benzenesulfonamide (PubChem CID 106341917) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)-N-[3-(methanesulfonamido)propyl]benzenesulfonamide.
| Compound Name | 3-(1-hydroxyethyl)-N-[3-(methanesulfonamido)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106341917 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-(1-hydroxyethyl)-N-[3-(methanesulfonamido)propyl]benzenesulfonamide |
| SMILES | CC(O)c1cccc(S(=O)(=O)NCCCNS(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H20N2O5S2/c1-10(15)11-5-3-6-12(9-11)21(18,19)14-8-4-7-13-20(2,16)17/h3,5-6,9-10,13-15H,4,7-8H2,1-2H3 |
| InChIKey | LQYUHZZEKGGFBU-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|