C12H19NO3S2 — CID 63960305
3-(1-hydroxyethyl)-N-(3-methylsulfanylpropyl)benzenesulfonamide (PubChem CID 63960305) has the molecular formula C12H19NO3S2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)-N-(3-methylsulfanylpropyl)benzenesulfonamide.
| Compound Name | 3-(1-hydroxyethyl)-N-(3-methylsulfanylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63960305 |
| Molecular Formula | C12H19NO3S2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 3-(1-hydroxyethyl)-N-(3-methylsulfanylpropyl)benzenesulfonamide |
| SMILES | CSCCCNS(=O)(=O)c1cccc(C(C)O)c1 |
| InChI | InChI=1S/C12H19NO3S2/c1-10(14)11-5-3-6-12(9-11)18(15,16)13-7-4-8-17-2/h3,5-6,9-10,13-14H,4,7-8H2,1-2H3 |
| InChIKey | BUMIYPBRCWDWMG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|