C10H16N2O5S2 — CID 106340026
3-hydroxy-N-[3-(methanesulfonamido)propyl]benzenesulfonamide (PubChem CID 106340026) has the molecular formula C10H16N2O5S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-hydroxy-N-[3-(methanesulfonamido)propyl]benzenesulfonamide.
| Compound Name | 3-hydroxy-N-[3-(methanesulfonamido)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106340026 |
| Molecular Formula | C10H16N2O5S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 3-hydroxy-N-[3-(methanesulfonamido)propyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)NCCCNS(=O)(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C10H16N2O5S2/c1-18(14,15)11-6-3-7-12-19(16,17)10-5-2-4-9(13)8-10/h2,4-5,8,11-13H,3,6-7H2,1H3 |
| InChIKey | BGMFCEKUWJXLJA-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|