C11H17FN2O4S2 — CID 39634777
3-fluoro-N-[3-(methanesulfonamido)propyl]-4-methylbenzenesulfonamide (PubChem CID 39634777) has the molecular formula C11H17FN2O4S2 and a molecular weight of 324.40 g/mol. Its IUPAC name is 3-fluoro-N-[3-(methanesulfonamido)propyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-fluoro-N-[3-(methanesulfonamido)propyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 39634777 |
| Molecular Formula | C11H17FN2O4S2 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 3-fluoro-N-[3-(methanesulfonamido)propyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCNS(C)(=O)=O)cc1F |
| InChI | InChI=1S/C11H17FN2O4S2/c1-9-4-5-10(8-11(9)12)20(17,18)14-7-3-6-13-19(2,15)16/h4-5,8,13-14H,3,6-7H2,1-2H3 |
| InChIKey | ZWWNYJMNFBHDEA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|