C10H17N3O5S2 — CID 106333265
3-amino-4-hydroxy-N-[3-(methanesulfonamido)propyl]benzenesulfonamide (PubChem CID 106333265) has the molecular formula C10H17N3O5S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 3-amino-4-hydroxy-N-[3-(methanesulfonamido)propyl]benzenesulfonamide.
| Compound Name | 3-amino-4-hydroxy-N-[3-(methanesulfonamido)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106333265 |
| Molecular Formula | C10H17N3O5S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3-amino-4-hydroxy-N-[3-(methanesulfonamido)propyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)NCCCNS(=O)(=O)c1ccc(O)c(N)c1 |
| InChI | InChI=1S/C10H17N3O5S2/c1-19(15,16)12-5-2-6-13-20(17,18)8-3-4-10(14)9(11)7-8/h3-4,7,12-14H,2,5-6,11H2,1H3 |
| InChIKey | QHWMCVVPNGATMW-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|