About 3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride
3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride (PubChem CID 53405187) has the molecular formula C9H15ClN2O4S
and a molecular weight of 282.75 g/mol. Its IUPAC name is 3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride |
| PubChem CID | 53405187 |
| Molecular Formula | C9H15ClN2O4S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride |
| SMILES | COCCNS(=O)(=O)c1ccc(O)c(N)c1.Cl |
| InChI | InChI=1S/C9H14N2O4S.ClH/c1-15-5-4-11-16(13,14)7-2-3-9(12)8(10)6-7;/h2-3,6,11-12H,4-5,10H2,1H3;1H |
| InChIKey | UDYXDRMCLHMSOM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride?
The IUPAC name of 3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride (CID 53405187) is 3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride.
What is the SMILES notation for 3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride?
The canonical SMILES for 3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride is COCCNS(=O)(=O)c1ccc(O)c(N)c1.Cl.
What is the InChIKey of 3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride?
The InChIKey is UDYXDRMCLHMSOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O4S.ClH/c1-15-5-4-11-16(13,14)7-2-3-9(12)8(10)6-7;/h2-3,6,11-12H,4-5,10H2,1H3;1H.
What are the key properties of 3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride?
3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride has a molecular weight of 282.75 g/mol, XLogP of 0.32, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-hydroxy-N-(2-methoxyethyl)benzenesulfonamide;hydrochloride is sourced from PubChem (CID 53405187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).