C12H20N2O3S — CID 64568806
3-amino-N-(2,3-dimethylbutyl)-4-hydroxybenzenesulfonamide (PubChem CID 64568806) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 3-amino-N-(2,3-dimethylbutyl)-4-hydroxybenzenesulfonamide.
| Compound Name | 3-amino-N-(2,3-dimethylbutyl)-4-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 64568806 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-amino-N-(2,3-dimethylbutyl)-4-hydroxybenzenesulfonamide |
| SMILES | CC(C)C(C)CNS(=O)(=O)c1ccc(O)c(N)c1 |
| InChI | InChI=1S/C12H20N2O3S/c1-8(2)9(3)7-14-18(16,17)10-4-5-12(15)11(13)6-10/h4-6,8-9,14-15H,7,13H2,1-3H3 |
| InChIKey | MJMWGHVWCYJAHI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|