C10H16N2O4S — CID 106840203
3-amino-4-hydroxy-N-(4-hydroxybutyl)benzenesulfonamide (PubChem CID 106840203) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 3-amino-4-hydroxy-N-(4-hydroxybutyl)benzenesulfonamide.
| Compound Name | 3-amino-4-hydroxy-N-(4-hydroxybutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106840203 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-amino-4-hydroxy-N-(4-hydroxybutyl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCCCCO)ccc1O |
| InChI | InChI=1S/C10H16N2O4S/c11-9-7-8(3-4-10(9)14)17(15,16)12-5-1-2-6-13/h3-4,7,12-14H,1-2,5-6,11H2 |
| InChIKey | XMNAVHJMHJXVJL-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|