C13H21N3O4S — CID 43348206
3-amino-4-hydroxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide (PubChem CID 43348206) has the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. Its IUPAC name is 3-amino-4-hydroxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide.
| Compound Name | 3-amino-4-hydroxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43348206 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 3-amino-4-hydroxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCCCN2CCOCC2)ccc1O |
| InChI | InChI=1S/C13H21N3O4S/c14-12-10-11(2-3-13(12)17)21(18,19)15-4-1-5-16-6-8-20-9-7-16/h2-3,10,15,17H,1,4-9,14H2 |
| InChIKey | RSYCPIJOCXLYHE-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|