C13H20N2O2S2 — CID 64597912
4-(2,3-dimethylbutylsulfamoyl)benzenecarbothioamide (PubChem CID 64597912) has the molecular formula C13H20N2O2S2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 4-(2,3-dimethylbutylsulfamoyl)benzenecarbothioamide.
| Compound Name | 4-(2,3-dimethylbutylsulfamoyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 64597912 |
| Molecular Formula | C13H20N2O2S2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 4-(2,3-dimethylbutylsulfamoyl)benzenecarbothioamide |
| SMILES | CC(C)C(C)CNS(=O)(=O)c1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C13H20N2O2S2/c1-9(2)10(3)8-15-19(16,17)12-6-4-11(5-7-12)13(14)18/h4-7,9-10,15H,8H2,1-3H3,(H2,14,18) |
| InChIKey | CEWMTDAIDJVBDV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|