C14H20N2O2S — CID 79195635
4-(cyanomethyl)-N-(2,3-dimethylbutyl)benzenesulfonamide (PubChem CID 79195635) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 4-(cyanomethyl)-N-(2,3-dimethylbutyl)benzenesulfonamide.
| Compound Name | 4-(cyanomethyl)-N-(2,3-dimethylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79195635 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-(cyanomethyl)-N-(2,3-dimethylbutyl)benzenesulfonamide |
| SMILES | CC(C)C(C)CNS(=O)(=O)c1ccc(CC#N)cc1 |
| InChI | InChI=1S/C14H20N2O2S/c1-11(2)12(3)10-16-19(17,18)14-6-4-13(5-7-14)8-9-15/h4-7,11-12,16H,8,10H2,1-3H3 |
| InChIKey | VYOXAFZFTKNLMD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |