C17H18N2O3S — CID 97239384
4-(cyanomethyl)-N-[(2R)-2-hydroxy-2-(2-methylphenyl)ethyl]benzenesulfonamide (PubChem CID 97239384) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 4-(cyanomethyl)-N-[(2R)-2-hydroxy-2-(2-methylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 4-(cyanomethyl)-N-[(2R)-2-hydroxy-2-(2-methylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 97239384 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-(cyanomethyl)-N-[(2R)-2-hydroxy-2-(2-methylphenyl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccccc1[C@@H](O)CNS(=O)(=O)c1ccc(CC#N)cc1 |
| InChI | InChI=1S/C17H18N2O3S/c1-13-4-2-3-5-16(13)17(20)12-19-23(21,22)15-8-6-14(7-9-15)10-11-18/h2-9,17,19-20H,10,12H2,1H3/t17-/m0/s1 |
| InChIKey | QUZRCWZYHICTFU-KRWDZBQOSA-N |
| XLogP | 2.07 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |