C11H12N2O4S — CID 79185253
3-[[4-(cyanomethyl)phenyl]sulfonylamino]propanoic acid (PubChem CID 79185253) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 3-[[4-(cyanomethyl)phenyl]sulfonylamino]propanoic acid.
| Compound Name | 3-[[4-(cyanomethyl)phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 79185253 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-[[4-(cyanomethyl)phenyl]sulfonylamino]propanoic acid |
| SMILES | N#CCc1ccc(S(=O)(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C11H12N2O4S/c12-7-5-9-1-3-10(4-2-9)18(16,17)13-8-6-11(14)15/h1-4,13H,5-6,8H2,(H,14,15) |
| InChIKey | CQOTYKFCIHGFMD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |