C12H15N3O3S — CID 79184919
2-[[4-(cyanomethyl)phenyl]sulfonylamino]-N-ethylacetamide (PubChem CID 79184919) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-[[4-(cyanomethyl)phenyl]sulfonylamino]-N-ethylacetamide.
| Compound Name | 2-[[4-(cyanomethyl)phenyl]sulfonylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 79184919 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-[[4-(cyanomethyl)phenyl]sulfonylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNS(=O)(=O)c1ccc(CC#N)cc1 |
| InChI | InChI=1S/C12H15N3O3S/c1-2-14-12(16)9-15-19(17,18)11-5-3-10(4-6-11)7-8-13/h3-6,15H,2,7,9H2,1H3,(H,14,16) |
| InChIKey | OADNIYBJECMJBS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |