C12H17N3O2S — CID 113282753
N-(2-amino-2-methylpropyl)-4-(cyanomethyl)benzenesulfonamide (PubChem CID 113282753) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-4-(cyanomethyl)benzenesulfonamide.
| Compound Name | N-(2-amino-2-methylpropyl)-4-(cyanomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113282753 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-4-(cyanomethyl)benzenesulfonamide |
| SMILES | CC(C)(N)CNS(=O)(=O)c1ccc(CC#N)cc1 |
| InChI | InChI=1S/C12H17N3O2S/c1-12(2,14)9-15-18(16,17)11-5-3-10(4-6-11)7-8-13/h3-6,15H,7,9,14H2,1-2H3 |
| InChIKey | UJEXWEWLPCMAMI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |