C12H14N2O2 — CID 24702557
2-[4-(cyanomethyl)phenoxy]-N-ethylacetamide (PubChem CID 24702557) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[4-(cyanomethyl)phenoxy]-N-ethylacetamide.
| Compound Name | 2-[4-(cyanomethyl)phenoxy]-N-ethylacetamide |
|---|---|
| PubChem CID | 24702557 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-[4-(cyanomethyl)phenoxy]-N-ethylacetamide |
| SMILES | CCNC(=O)COc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C12H14N2O2/c1-2-14-12(15)9-16-11-5-3-10(4-6-11)7-8-13/h3-6H,2,7,9H2,1H3,(H,14,15) |
| InChIKey | KAZRFHGFACDLIP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |