C18H18N2O4S — CID 47078845
2-[4-(cyanomethyl)phenoxy]-N-(2-ethylsulfonylphenyl)acetamide (PubChem CID 47078845) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-[4-(cyanomethyl)phenoxy]-N-(2-ethylsulfonylphenyl)acetamide.
| Compound Name | 2-[4-(cyanomethyl)phenoxy]-N-(2-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 47078845 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2-[4-(cyanomethyl)phenoxy]-N-(2-ethylsulfonylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccccc1NC(=O)COc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C18H18N2O4S/c1-2-25(22,23)17-6-4-3-5-16(17)20-18(21)13-24-15-9-7-14(8-10-15)11-12-19/h3-10H,2,11,13H2,1H3,(H,20,21) |
| InChIKey | RDQYMHMOJKFSMD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |