C24H22N4O3 — CID 55848331
2-[4-(cyanomethyl)phenoxy]-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]acetamide (PubChem CID 55848331) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-[4-(cyanomethyl)phenoxy]-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2-[4-(cyanomethyl)phenoxy]-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 55848331 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-[4-(cyanomethyl)phenoxy]-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)Nc2ccccc2)cc1NC(=O)COc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C24H22N4O3/c1-17-7-10-20(27-24(30)26-19-5-3-2-4-6-19)15-22(17)28-23(29)16-31-21-11-8-18(9-12-21)13-14-25/h2-12,15H,13,16H2,1H3,(H,28,29)(H2,26,27,30) |
| InChIKey | RIJYBHGBQIXSPT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |