C16H14FN3O2 — CID 16784468
N-(3-amino-4-fluorophenyl)-2-[4-(cyanomethyl)phenoxy]acetamide (PubChem CID 16784468) has the molecular formula C16H14FN3O2 and a molecular weight of 299.31 g/mol. Its IUPAC name is N-(3-amino-4-fluorophenyl)-2-[4-(cyanomethyl)phenoxy]acetamide.
| Compound Name | N-(3-amino-4-fluorophenyl)-2-[4-(cyanomethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 16784468 |
| Molecular Formula | C16H14FN3O2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-(3-amino-4-fluorophenyl)-2-[4-(cyanomethyl)phenoxy]acetamide |
| SMILES | N#CCc1ccc(OCC(=O)Nc2ccc(F)c(N)c2)cc1 |
| InChI | InChI=1S/C16H14FN3O2/c17-14-6-3-12(9-15(14)19)20-16(21)10-22-13-4-1-11(2-5-13)7-8-18/h1-6,9H,7,10,19H2,(H,20,21) |
| InChIKey | ORPOOAACJYTEPS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|