C14H11F3N2O2 — CID 43554704
N-(3-amino-4-fluorophenyl)-2-(3,4-difluorophenoxy)acetamide (PubChem CID 43554704) has the molecular formula C14H11F3N2O2 and a molecular weight of 296.25 g/mol. Its IUPAC name is N-(3-amino-4-fluorophenyl)-2-(3,4-difluorophenoxy)acetamide.
| Compound Name | N-(3-amino-4-fluorophenyl)-2-(3,4-difluorophenoxy)acetamide |
|---|---|
| PubChem CID | 43554704 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-(3-amino-4-fluorophenyl)-2-(3,4-difluorophenoxy)acetamide |
| SMILES | Nc1cc(NC(=O)COc2ccc(F)c(F)c2)ccc1F |
| InChI | InChI=1S/C14H11F3N2O2/c15-10-4-2-9(6-12(10)17)21-7-14(20)19-8-1-3-11(16)13(18)5-8/h1-6H,7,18H2,(H,19,20) |
| InChIKey | ARASLONYSBSWGV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|