C14H21N3O5S2 — CID 55365065
N-ethyl-2-[(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylamino]acetamide (PubChem CID 55365065) has the molecular formula C14H21N3O5S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-ethyl-2-[(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylamino]acetamide.
| Compound Name | N-ethyl-2-[(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 55365065 |
| Molecular Formula | C14H21N3O5S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-ethyl-2-[(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylamino]acetamide |
| SMILES | CCNC(=O)CNS(=O)(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C14H21N3O5S2/c1-2-15-14(18)11-16-23(19,20)12-5-7-13(8-6-12)24(21,22)17-9-3-4-10-17/h5-8,16H,2-4,9-11H2,1H3,(H,15,18) |
| InChIKey | KAUVGJCJXKHLAQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |