C16H23N2O6S2- — CID 2555951
6-[(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylamino]hexanoate (PubChem CID 2555951) has the molecular formula C16H23N2O6S2- and a molecular weight of 403.50 g/mol. Its IUPAC name is 6-[(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylamino]hexanoate.
| Compound Name | 6-[(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 2555951 |
| Molecular Formula | C16H23N2O6S2- |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 6-[(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylamino]hexanoate |
| SMILES | O=C([O-])CCCCCNS(=O)(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C16H24N2O6S2/c19-16(20)6-2-1-3-11-17-25(21,22)14-7-9-15(10-8-14)26(23,24)18-12-4-5-13-18/h7-10,17H,1-6,11-13H2,(H,19,20)/p-1 |
| InChIKey | WUYSAHQQHNINMJ-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|