C13H21N3O4S2 — CID 119962244
N-(3-aminopropyl)-3-pyrrolidin-1-ylsulfonylbenzenesulfonamide (PubChem CID 119962244) has the molecular formula C13H21N3O4S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-pyrrolidin-1-ylsulfonylbenzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-3-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 119962244 |
| Molecular Formula | C13H21N3O4S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-(3-aminopropyl)-3-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
| SMILES | NCCCNS(=O)(=O)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C13H21N3O4S2/c14-7-4-8-15-21(17,18)12-5-3-6-13(11-12)22(19,20)16-9-1-2-10-16/h3,5-6,11,15H,1-2,4,7-10,14H2 |
| InChIKey | VDXPISOUZKTZDT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|