C10H16Cl2N2O2S — CID 119962113
N-(3-aminopropyl)-3-chloro-4-methylbenzenesulfonamide;hydrochloride (PubChem CID 119962113) has the molecular formula C10H16Cl2N2O2S and a molecular weight of 299.22 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-chloro-4-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-3-chloro-4-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119962113 |
| Molecular Formula | C10H16Cl2N2O2S |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | N-(3-aminopropyl)-3-chloro-4-methylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)NCCCN)cc1Cl.Cl |
| InChI | InChI=1S/C10H15ClN2O2S.ClH/c1-8-3-4-9(7-10(8)11)16(14,15)13-6-2-5-12;/h3-4,7,13H,2,5-6,12H2,1H3;1H |
| InChIKey | QTFIQMACLJSZRI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|