C12H17F3N2O2S — CID 120583345
N-(4-aminobutyl)-4-methyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 120583345) has the molecular formula C12H17F3N2O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is N-(4-aminobutyl)-4-methyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(4-aminobutyl)-4-methyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120583345 |
| Molecular Formula | C12H17F3N2O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(4-aminobutyl)-4-methyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCN)cc1C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O2S/c1-9-4-5-10(8-11(9)12(13,14)15)20(18,19)17-7-3-2-6-16/h4-5,8,17H,2-3,6-7,16H2,1H3 |
| InChIKey | BHMUOGJBWPXAMA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|