C12H21ClFN3O4S2 — CID 120583201
N-(4-aminobutyl)-4-(ethylsulfonylamino)-3-fluorobenzenesulfonamide;hydrochloride (PubChem CID 120583201) has the molecular formula C12H21ClFN3O4S2 and a molecular weight of 389.90 g/mol. Its IUPAC name is N-(4-aminobutyl)-4-(ethylsulfonylamino)-3-fluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-(4-aminobutyl)-4-(ethylsulfonylamino)-3-fluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120583201 |
| Molecular Formula | C12H21ClFN3O4S2 |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N-(4-aminobutyl)-4-(ethylsulfonylamino)-3-fluorobenzenesulfonamide;hydrochloride |
| SMILES | CCS(=O)(=O)Nc1ccc(S(=O)(=O)NCCCCN)cc1F.Cl |
| InChI | InChI=1S/C12H20FN3O4S2.ClH/c1-2-21(17,18)16-12-6-5-10(9-11(12)13)22(19,20)15-8-4-3-7-14;/h5-6,9,15-16H,2-4,7-8,14H2,1H3;1H |
| InChIKey | UXHLCZTUFNAALN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|