C15H23ClFN3O3S — CID 120583476
N-(4-aminobutyl)-3-fluoro-4-(pyrrolidine-1-carbonyl)benzenesulfonamide;hydrochloride (PubChem CID 120583476) has the molecular formula C15H23ClFN3O3S and a molecular weight of 379.89 g/mol. Its IUPAC name is N-(4-aminobutyl)-3-fluoro-4-(pyrrolidine-1-carbonyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-(4-aminobutyl)-3-fluoro-4-(pyrrolidine-1-carbonyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120583476 |
| Molecular Formula | C15H23ClFN3O3S |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-(4-aminobutyl)-3-fluoro-4-(pyrrolidine-1-carbonyl)benzenesulfonamide;hydrochloride |
| SMILES | Cl.NCCCCNS(=O)(=O)c1ccc(C(=O)N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C15H22FN3O3S.ClH/c16-14-11-12(23(21,22)18-8-2-1-7-17)5-6-13(14)15(20)19-9-3-4-10-19;/h5-6,11,18H,1-4,7-10,17H2;1H |
| InChIKey | BDBSGSCVODDYCT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|