C12H18FN3O3S — CID 120583268
N-[5-(4-aminobutylsulfamoyl)-2-fluorophenyl]acetamide (PubChem CID 120583268) has the molecular formula C12H18FN3O3S and a molecular weight of 303.36 g/mol. Its IUPAC name is N-[5-(4-aminobutylsulfamoyl)-2-fluorophenyl]acetamide.
| Compound Name | N-[5-(4-aminobutylsulfamoyl)-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 120583268 |
| Molecular Formula | C12H18FN3O3S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-[5-(4-aminobutylsulfamoyl)-2-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)NCCCCN)ccc1F |
| InChI | InChI=1S/C12H18FN3O3S/c1-9(17)16-12-8-10(4-5-11(12)13)20(18,19)15-7-3-2-6-14/h4-5,8,15H,2-3,6-7,14H2,1H3,(H,16,17) |
| InChIKey | NFXXHUCZSUXYCD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|