C12H19BrClN3O3S — CID 120713453
N-[4-(4-aminobutylsulfamoyl)-2-bromophenyl]acetamide;hydrochloride (PubChem CID 120713453) has the molecular formula C12H19BrClN3O3S and a molecular weight of 400.73 g/mol. Its IUPAC name is N-[4-(4-aminobutylsulfamoyl)-2-bromophenyl]acetamide;hydrochloride.
| Compound Name | N-[4-(4-aminobutylsulfamoyl)-2-bromophenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120713453 |
| Molecular Formula | C12H19BrClN3O3S |
| Molecular Weight | 400.73 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | N-[4-(4-aminobutylsulfamoyl)-2-bromophenyl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCCCN)cc1Br.Cl |
| InChI | InChI=1S/C12H18BrN3O3S.ClH/c1-9(17)16-12-5-4-10(8-11(12)13)20(18,19)15-7-3-2-6-14;/h4-5,8,15H,2-3,6-7,14H2,1H3,(H,16,17);1H |
| InChIKey | JSSMFIDOKCMOSP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.73 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|