C11H19ClN2O2S — CID 120583806
N-(4-aminobutyl)-4-methylbenzenesulfonamide;hydrochloride (PubChem CID 120583806) has the molecular formula C11H19ClN2O2S and a molecular weight of 278.80 g/mol. Its IUPAC name is N-(4-aminobutyl)-4-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(4-aminobutyl)-4-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120583806 |
| Molecular Formula | C11H19ClN2O2S |
| Molecular Weight | 278.80 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-(4-aminobutyl)-4-methylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCN)cc1.Cl |
| InChI | InChI=1S/C11H18N2O2S.ClH/c1-10-4-6-11(7-5-10)16(14,15)13-9-3-2-8-12;/h4-7,13H,2-3,8-9,12H2,1H3;1H |
| InChIKey | BVZYWLXQRHGJLG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.80 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|