C11H15F3N2O2S — CID 119972929
4-methyl-N-[2-(methylamino)ethyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 119972929) has the molecular formula C11H15F3N2O2S and a molecular weight of 296.31 g/mol. Its IUPAC name is 4-methyl-N-[2-(methylamino)ethyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-(methylamino)ethyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119972929 |
| Molecular Formula | C11H15F3N2O2S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-methyl-N-[2-(methylamino)ethyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CNCCNS(=O)(=O)c1ccc(C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H15F3N2O2S/c1-8-3-4-9(7-10(8)11(12,13)14)19(17,18)16-6-5-15-2/h3-4,7,15-16H,5-6H2,1-2H3 |
| InChIKey | PGQPCWDVJBNODW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|