C11H13ClF3N3O2S — CID 119973335
4-cyano-N-[2-(methylamino)ethyl]-3-(trifluoromethyl)benzenesulfonamide;hydrochloride (PubChem CID 119973335) has the molecular formula C11H13ClF3N3O2S and a molecular weight of 343.76 g/mol. Its IUPAC name is 4-cyano-N-[2-(methylamino)ethyl]-3-(trifluoromethyl)benzenesulfonamide;hydrochloride.
| Compound Name | 4-cyano-N-[2-(methylamino)ethyl]-3-(trifluoromethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119973335 |
| Molecular Formula | C11H13ClF3N3O2S |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 4-cyano-N-[2-(methylamino)ethyl]-3-(trifluoromethyl)benzenesulfonamide;hydrochloride |
| SMILES | CNCCNS(=O)(=O)c1ccc(C#N)c(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C11H12F3N3O2S.ClH/c1-16-4-5-17-20(18,19)9-3-2-8(7-15)10(6-9)11(12,13)14;/h2-3,6,16-17H,4-5H2,1H3;1H |
| InChIKey | ODGLQUCXLBZPLA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|