C10H12FN3O4S2 — CID 63239611
3-cyano-4-fluoro-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide (PubChem CID 63239611) has the molecular formula C10H12FN3O4S2 and a molecular weight of 321.36 g/mol. Its IUPAC name is 3-cyano-4-fluoro-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide.
| Compound Name | 3-cyano-4-fluoro-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63239611 |
| Molecular Formula | C10H12FN3O4S2 |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 3-cyano-4-fluoro-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)NCCNS(=O)(=O)c1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C10H12FN3O4S2/c1-19(15,16)13-4-5-14-20(17,18)9-2-3-10(11)8(6-9)7-12/h2-3,6,13-14H,4-5H2,1H3 |
| InChIKey | AEPSGSKNZAFSGJ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|