C10H9FN2O4S — CID 63288390
3-[(3-cyano-4-fluorophenyl)sulfonylamino]propanoic acid (PubChem CID 63288390) has the molecular formula C10H9FN2O4S and a molecular weight of 272.26 g/mol. Its IUPAC name is 3-[(3-cyano-4-fluorophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(3-cyano-4-fluorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 63288390 |
| Molecular Formula | C10H9FN2O4S |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 3-[(3-cyano-4-fluorophenyl)sulfonylamino]propanoic acid |
| SMILES | N#Cc1cc(S(=O)(=O)NCCC(=O)O)ccc1F |
| InChI | InChI=1S/C10H9FN2O4S/c11-9-2-1-8(5-7(9)6-12)18(16,17)13-4-3-10(14)15/h1-2,5,13H,3-4H2,(H,14,15) |
| InChIKey | BYYFPLJOGIWKDQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |