C12H11F3N2O4S — CID 120728768
4-[[3-cyano-4-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid (PubChem CID 120728768) has the molecular formula C12H11F3N2O4S and a molecular weight of 336.29 g/mol. Its IUPAC name is 4-[[3-cyano-4-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid.
| Compound Name | 4-[[3-cyano-4-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 120728768 |
| Molecular Formula | C12H11F3N2O4S |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 4-[[3-cyano-4-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid |
| SMILES | N#Cc1cc(S(=O)(=O)NCCCC(=O)O)ccc1C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O4S/c13-12(14,15)10-4-3-9(6-8(10)7-16)22(20,21)17-5-1-2-11(18)19/h3-4,6,17H,1-2,5H2,(H,18,19) |
| InChIKey | DTMGWQAIXJLPTO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|