C10H10F3N3O2S — CID 120998831
N-(2-aminoethyl)-3-cyano-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 120998831) has the molecular formula C10H10F3N3O2S and a molecular weight of 293.27 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-cyano-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-aminoethyl)-3-cyano-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120998831 |
| Molecular Formula | C10H10F3N3O2S |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | N-(2-aminoethyl)-3-cyano-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | N#Cc1cc(S(=O)(=O)NCCN)ccc1C(F)(F)F |
| InChI | InChI=1S/C10H10F3N3O2S/c11-10(12,13)9-2-1-8(5-7(9)6-15)19(17,18)16-4-3-14/h1-2,5,16H,3-4,14H2 |
| InChIKey | ICOICGHQSWWEGR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |