C12H10FN3O2S2 — CID 63239719
3-cyano-4-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide (PubChem CID 63239719) has the molecular formula C12H10FN3O2S2 and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-cyano-4-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-cyano-4-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63239719 |
| Molecular Formula | C12H10FN3O2S2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 3-cyano-4-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
| SMILES | N#Cc1cc(S(=O)(=O)NCCc2nccs2)ccc1F |
| InChI | InChI=1S/C12H10FN3O2S2/c13-11-2-1-10(7-9(11)8-14)20(17,18)16-4-3-12-15-5-6-19-12/h1-2,5-7,16H,3-4H2 |
| InChIKey | BKTYDHUJLRJFSX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |