C14H12FN3O2S — CID 63288706
3-cyano-4-fluoro-N-(2-pyridin-4-ylethyl)benzenesulfonamide (PubChem CID 63288706) has the molecular formula C14H12FN3O2S and a molecular weight of 305.33 g/mol. Its IUPAC name is 3-cyano-4-fluoro-N-(2-pyridin-4-ylethyl)benzenesulfonamide.
| Compound Name | 3-cyano-4-fluoro-N-(2-pyridin-4-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63288706 |
| Molecular Formula | C14H12FN3O2S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 3-cyano-4-fluoro-N-(2-pyridin-4-ylethyl)benzenesulfonamide |
| SMILES | N#Cc1cc(S(=O)(=O)NCCc2ccncc2)ccc1F |
| InChI | InChI=1S/C14H12FN3O2S/c15-14-2-1-13(9-12(14)10-16)21(19,20)18-8-5-11-3-6-17-7-4-11/h1-4,6-7,9,18H,5,8H2 |
| InChIKey | YPDVFBLRISJJDJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |