C12H14F3N3O2S — CID 119988446
N-(2-amino-2-methylpropyl)-4-cyano-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 119988446) has the molecular formula C12H14F3N3O2S and a molecular weight of 321.32 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-4-cyano-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-amino-2-methylpropyl)-4-cyano-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119988446 |
| Molecular Formula | C12H14F3N3O2S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-4-cyano-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)(N)CNS(=O)(=O)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3N3O2S/c1-11(2,17)7-18-21(19,20)9-4-3-8(6-16)10(5-9)12(13,14)15/h3-5,18H,7,17H2,1-2H3 |
| InChIKey | LWTLJWPODGSPRT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |