C13H13F3N2O3S — CID 94188912
(2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]sulfonyl-2-methylbutanamide (PubChem CID 94188912) has the molecular formula C13H13F3N2O3S and a molecular weight of 334.32 g/mol. Its IUPAC name is (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]sulfonyl-2-methylbutanamide.
| Compound Name | (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]sulfonyl-2-methylbutanamide |
|---|---|
| PubChem CID | 94188912 |
| Molecular Formula | C13H13F3N2O3S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]sulfonyl-2-methylbutanamide |
| SMILES | CC[C@H](C)C(=O)NS(=O)(=O)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3N2O3S/c1-3-8(2)12(19)18-22(20,21)10-5-4-9(7-17)11(6-10)13(14,15)16/h4-6,8H,3H2,1-2H3,(H,18,19)/t8-/m0/s1 |
| InChIKey | KOXNXBJZNBJVES-QMMMGPOBSA-N |
| XLogP | 2.43 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |