C15H20F3NO4S — CID 167867168
2-ethyl-4-methoxy-N-[4-methyl-3-(trifluoromethyl)phenyl]sulfonylbutanamide (PubChem CID 167867168) has the molecular formula C15H20F3NO4S and a molecular weight of 367.39 g/mol. Its IUPAC name is 2-ethyl-4-methoxy-N-[4-methyl-3-(trifluoromethyl)phenyl]sulfonylbutanamide.
| Compound Name | 2-ethyl-4-methoxy-N-[4-methyl-3-(trifluoromethyl)phenyl]sulfonylbutanamide |
|---|---|
| PubChem CID | 167867168 |
| Molecular Formula | C15H20F3NO4S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-ethyl-4-methoxy-N-[4-methyl-3-(trifluoromethyl)phenyl]sulfonylbutanamide |
| SMILES | CCC(CCOC)C(=O)NS(=O)(=O)c1ccc(C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3NO4S/c1-4-11(7-8-23-3)14(20)19-24(21,22)12-6-5-10(2)13(9-12)15(16,17)18/h5-6,9,11H,4,7-8H2,1-3H3,(H,19,20) |
| InChIKey | BUZIQLIQFVUHIK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |