C13H15ClN2O4S — CID 98771742
(2S)-N-(3-chloro-4-cyanophenyl)sulfonyl-2-ethoxybutanamide (PubChem CID 98771742) has the molecular formula C13H15ClN2O4S and a molecular weight of 330.79 g/mol. Its IUPAC name is (2S)-N-(3-chloro-4-cyanophenyl)sulfonyl-2-ethoxybutanamide.
| Compound Name | (2S)-N-(3-chloro-4-cyanophenyl)sulfonyl-2-ethoxybutanamide |
|---|---|
| PubChem CID | 98771742 |
| Molecular Formula | C13H15ClN2O4S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (2S)-N-(3-chloro-4-cyanophenyl)sulfonyl-2-ethoxybutanamide |
| SMILES | CCO[C@@H](CC)C(=O)NS(=O)(=O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClN2O4S/c1-3-12(20-4-2)13(17)16-21(18,19)10-6-5-9(8-15)11(14)7-10/h5-7,12H,3-4H2,1-2H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | QRSCCAIQIOOCKM-LBPRGKRZSA-N |
| XLogP | 1.83 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |