C12H13ClN2O3S — CID 146125461
N-(3-chloro-4-cyanophenyl)sulfonyl-2,2-dimethylpropanamide (PubChem CID 146125461) has the molecular formula C12H13ClN2O3S and a molecular weight of 300.77 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)sulfonyl-2,2-dimethylpropanamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)sulfonyl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 146125461 |
| Molecular Formula | C12H13ClN2O3S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)sulfonyl-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NS(=O)(=O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2O3S/c1-12(2,3)11(16)15-19(17,18)9-5-4-8(7-14)10(13)6-9/h4-6H,1-3H3,(H,15,16) |
| InChIKey | UGTNJTKZEXTIBI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |