C11H14ClNO3S — CID 47269831
N-(3-chlorophenyl)sulfonyl-2,2-dimethylpropanamide (PubChem CID 47269831) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is N-(3-chlorophenyl)sulfonyl-2,2-dimethylpropanamide.
| Compound Name | N-(3-chlorophenyl)sulfonyl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 47269831 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | N-(3-chlorophenyl)sulfonyl-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H14ClNO3S/c1-11(2,3)10(14)13-17(15,16)9-6-4-5-8(12)7-9/h4-7H,1-3H3,(H,13,14) |
| InChIKey | GNFSRHGZEXIIHR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |