C10H13ClN2O2S2 — CID 119088818
1-(3-chlorophenyl)sulfonyl-3-propylthiourea (PubChem CID 119088818) has the molecular formula C10H13ClN2O2S2 and a molecular weight of 292.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-3-propylthiourea.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-3-propylthiourea |
|---|---|
| PubChem CID | 119088818 |
| Molecular Formula | C10H13ClN2O2S2 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-3-propylthiourea |
| SMILES | CCCNC(=S)NS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H13ClN2O2S2/c1-2-6-12-10(16)13-17(14,15)9-5-3-4-8(11)7-9/h3-5,7H,2,6H2,1H3,(H2,12,13,16) |
| InChIKey | GKVNKCWDRPFNMB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|