C12H19ClN2O3S2 — CID 166135622
3-chloro-N-[2-hydroxyethylsulfanyl(propylamino)methyl]benzenesulfonamide (PubChem CID 166135622) has the molecular formula C12H19ClN2O3S2 and a molecular weight of 338.88 g/mol. Its IUPAC name is 3-chloro-N-[2-hydroxyethylsulfanyl(propylamino)methyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[2-hydroxyethylsulfanyl(propylamino)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166135622 |
| Molecular Formula | C12H19ClN2O3S2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 3-chloro-N-[2-hydroxyethylsulfanyl(propylamino)methyl]benzenesulfonamide |
| SMILES | CCCNC(NS(=O)(=O)c1cccc(Cl)c1)SCCO |
| InChI | InChI=1S/C12H19ClN2O3S2/c1-2-6-14-12(19-8-7-16)15-20(17,18)11-5-3-4-10(13)9-11/h3-5,9,12,14-16H,2,6-8H2,1H3 |
| InChIKey | UBYDXIGCLYQUIA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|