C12H17ClN2O4S — CID 131856473
(2R)-2-[(3-chlorophenyl)sulfonylamino]-N-hydroxyhexanamide (PubChem CID 131856473) has the molecular formula C12H17ClN2O4S and a molecular weight of 320.80 g/mol. Its IUPAC name is (2R)-2-[(3-chlorophenyl)sulfonylamino]-N-hydroxyhexanamide.
| Compound Name | (2R)-2-[(3-chlorophenyl)sulfonylamino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 131856473 |
| Molecular Formula | C12H17ClN2O4S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (2R)-2-[(3-chlorophenyl)sulfonylamino]-N-hydroxyhexanamide |
| SMILES | CCCC[C@@H](NS(=O)(=O)c1cccc(Cl)c1)C(=O)NO |
| InChI | InChI=1S/C12H17ClN2O4S/c1-2-3-7-11(12(16)14-17)15-20(18,19)10-6-4-5-9(13)8-10/h4-6,8,11,15,17H,2-3,7H2,1H3,(H,14,16)/t11-/m1/s1 |
| InChIKey | BBNOAYAMRNFOED-LLVKDONJSA-N |
| XLogP | 1.68 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|